|
CAS#: 77694-45-2 Product: 3-(4-Chlorophenyl)-1-(2-Oxooxolan-3-Yl)Urea No suppilers available for the product. |
| Name | 3-(4-Chlorophenyl)-1-(2-Oxooxolan-3-Yl)Urea |
|---|---|
| Synonyms | 3-(4-Chlorophenyl)-1-(2-Oxotetrahydrofuran-3-Yl)Urea; 3-(4-Chlorophenyl)-1-(2-Oxo-3-Tetrahydrofuranyl)Urea; 3-(4-Chlorophenyl)-1-(2-Ketotetrahydrofuran-3-Yl)Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 |
| CAS Registry Number | 77694-45-2 |
| SMILES | C1=CC(=CC=C1NC(=O)NC2C(OCC2)=O)Cl |
| InChI | 1S/C11H11ClN2O3/c12-7-1-3-8(4-2-7)13-11(16)14-9-5-6-17-10(9)15/h1-4,9H,5-6H2,(H2,13,14,16) |
| InChIKey | XLNXTTAJRCKFBW-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.56°C at 760 mmHg (Cal.) |
| Flash point | 220.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chlorophenyl)-1-(2-Oxooxolan-3-Yl)Urea |