|
CAS#: 7774-60-9 Product: 1-Methyl-1-Phenylethyl Isobutyrate No suppilers available for the product. |
| Name | 1-Methyl-1-Phenylethyl Isobutyrate |
|---|---|
| Synonyms | (1-Methyl-1-Phenyl-Ethyl) 2-Methylpropanoate; 2-Methylpropanoic Acid (1-Methyl-1-Phenylethyl) Ester; 2-Methylpropionic Acid (1-Methyl-1-Phenyl-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 7774-60-9 |
| EINECS | 231-876-4 |
| FEMA | 2388 |
| SMILES | C1=CC=C(C=C1)C(OC(=O)C(C)C)(C)C |
| InChI | 1S/C13H18O2/c1-10(2)12(14)15-13(3,4)11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | LQOHUFIIIKBPQC-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.216°C at 760 mmHg (Cal.) |
| Flash point | 93.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1-Phenylethyl Isobutyrate |