|
CAS#: 77779-50-1 Product: 2-(4-Methoxyphenyl)-1H-Pyrazolo[4,5-c]Quinolin-3-One No suppilers available for the product. |
| Name | 2-(4-Methoxyphenyl)-1H-Pyrazolo[4,5-c]Quinolin-3-One |
|---|---|
| Synonyms | Cgs-9895; Nsc 373970; 2-(4-Methoxyphenyl)-2,5-Dihydro-3H-Pyrazolo[4,3-C]Quinolin-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 |
| CAS Registry Number | 77779-50-1 |
| SMILES | C2=NC1=CC=CC=C1C3=C2C(=O)N(N3)C4=CC=C(OC)C=C4 |
| InChI | 1S/C17H13N3O2/c1-22-12-8-6-11(7-9-12)20-17(21)14-10-18-15-5-3-2-4-13(15)16(14)19-20/h2-10,19H,1H3 |
| InChIKey | FTHGIXILGYJOBQ-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.624°C at 760 mmHg (Cal.) |
| Flash point | 267.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methoxyphenyl)-1H-Pyrazolo[4,5-c]Quinolin-3-One |