|
CAS#: 7780-33-8 Product: Dowco 105 No suppilers available for the product. |
| Name | Dowco 105 |
|---|---|
| Synonyms | N-[(4-Tert-Butyl-2-Chloro-Phenoxy)-Methoxy-Phosphinothioyl]Ethanamine; [(4-Tert-Butyl-2-Chloro-Phenoxy)-Methoxy-Thiophosphoryl]-Ethyl-Amine; Dowco 105 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21ClNO2PS |
| Molecular Weight | 321.80 |
| CAS Registry Number | 7780-33-8 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1Cl)O[P](=S)(OC)NCC |
| InChI | 1S/C13H21ClNO2PS/c1-6-15-18(19,16-5)17-12-8-7-10(9-11(12)14)13(2,3)4/h7-9H,6H2,1-5H3,(H,15,19) |
| InChIKey | VQRMLSCAJOMIHI-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.143°C at 760 mmHg (Cal.) |
| Flash point | 171.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dowco 105 |