|
CAS#: 78000-39-2 Product: 3-Methyl-2-oxobutanoic acid - L-histidine (1:1) No suppilers available for the product. |
| Name | 3-Methyl-2-oxobutanoic acid - L-histidine (1:1) |
|---|---|
| Synonyms | L-histidine mono(3-methyl-2-oxobutyrate) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 |
| CAS Registry Number | 78000-39-2 |
| EINECS | 278-815-8 |
| SMILES | N[C@@H](Cc1cncn1)C(O)=O.CC(C)C(=O)C(O)=O |
| InChI | 1S/C6H9N3O2.C5H8O3/c7-5(6(10)11)1-4-2-8-3-9-4;1-3(2)4(6)5(7)8/h2-3,5H,1,7H2,(H,8,9)(H,10,11);3H,1-2H3,(H,7,8)/t5-;/m0./s1 |
| InChIKey | TWBDHGZHCGZKOQ-JEDNCBNOSA-N |
| Boiling point | 550.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 286.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-oxobutanoic acid - L-histidine (1:1) |