|
CAS#: 7801-32-3 Product: 1,2,4,5-Tetrahydrotestolactone No suppilers available for the product. |
| Name | 1,2,4,5-Tetrahydrotestolactone |
|---|---|
| Synonyms | (4As,4Br,6As,10As,10Bs,12As)-10A,12A-Dimethyl-4,4A,4B,5,6,6A,7,9,10,10B,11,12-Dodecahydro-3H-Naphtho[6,5-F]Chromene-2,8-Quinone; 1,2,4,5-Tetrahydrotestolactone; Nsc34417 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 |
| CAS Registry Number | 7801-32-3 |
| SMILES | [C@@]12([C@@H](CCC(O1)=O)[C@H]4[C@H](CC2)[C@]3(CCC(C[C@@H]3CC4)=O)C)C |
| InChI | 1S/C19H28O3/c1-18-9-7-13(20)11-12(18)3-4-14-15(18)8-10-19(2)16(14)5-6-17(21)22-19/h12,14-16H,3-11H2,1-2H3/t12-,14+,15-,16-,18-,19-/m0/s1 |
| InChIKey | CXFWIKINSICEBC-ARKCUIHYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.165°C at 760 mmHg (Cal.) |
| Flash point | 200.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrahydrotestolactone |