|
CAS#: 78092-66-7 Product: 2-((4-Pyridylmethyl)thio)ethanol phosphate (1:1) (salt) No suppilers available for the product. |
| Name | 2-((4-Pyridylmethyl)thio)ethanol phosphate (1:1) (salt) |
|---|---|
| Synonyms | Phosphoric Acid; 2-(4-Pyridylmethylsulfanyl)Ethanol; Phosphoric Acid; 2-(4-Pyridylmethylthio)Ethanol; Ristianol Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14NO5PS |
| Molecular Weight | 267.24 |
| CAS Registry Number | 78092-66-7 |
| SMILES | C1=C(C=CN=C1)CSCCO.O=[P](O)(O)O |
| InChI | 1S/C8H11NOS.H3O4P/c10-5-6-11-7-8-1-3-9-4-2-8;1-5(2,3)4/h1-4,10H,5-7H2;(H3,1,2,3,4) |
| InChIKey | CMJVTGWDYPQSTL-UHFFFAOYSA-N |
| Boiling point | 331.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 154.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-((4-Pyridylmethyl)thio)ethanol phosphate (1:1) (salt) |