|
CAS#: 78164-40-6 Product: 4-(4-Bromophenyl)-2-Methyl-5-Nitro-1,3-Oxazole No suppilers available for the product. |
| Name | 4-(4-Bromophenyl)-2-Methyl-5-Nitro-1,3-Oxazole |
|---|---|
| Synonyms | 4-(4-Bromophenyl)-2-Methyl-5-Nitro-Oxazole; 4-(4-Bromophenyl)-2-Methyl-5-Nitrooxazole; S-20344 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7BrN2O3 |
| Molecular Weight | 283.08 |
| CAS Registry Number | 78164-40-6 |
| SMILES | C1=CC(=CC=C1C2=C(OC(=N2)C)[N+]([O-])=O)Br |
| InChI | 1S/C10H7BrN2O3/c1-6-12-9(10(16-6)13(14)15)7-2-4-8(11)5-3-7/h2-5H,1H3 |
| InChIKey | FZEZSAYAMCCVHV-UHFFFAOYSA-N |
| Density | 1.617g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.936°C at 760 mmHg (Cal.) |
| Flash point | 184.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Bromophenyl)-2-Methyl-5-Nitro-1,3-Oxazole |