|
CAS#: 78214-14-9 Product: 2-[(E)-2-(3-Methoxyphenyl)Ethenyl]-3,1-Benzoxazin-4-One No suppilers available for the product. |
| Name | 2-[(E)-2-(3-Methoxyphenyl)Ethenyl]-3,1-Benzoxazin-4-One |
|---|---|
| Synonyms | 2-[(E)-2-(3-Methoxyphenyl)Vinyl]-3,1-Benzoxazin-4-One; 4H-3,1-Benzoxazin-4-One, 2-(2-(3-Methoxyphenyl)Ethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 |
| CAS Registry Number | 78214-14-9 |
| SMILES | C1=C2C(=CC=C1)N=C(OC2=O)\C=C\C3=CC=CC(=C3)OC |
| InChI | 1S/C17H13NO3/c1-20-13-6-4-5-12(11-13)9-10-16-18-15-8-3-2-7-14(15)17(19)21-16/h2-11H,1H3/b10-9+ |
| InChIKey | NODJLUIXDICTEH-MDZDMXLPSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.253°C at 760 mmHg (Cal.) |
| Flash point | 209.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(E)-2-(3-Methoxyphenyl)Ethenyl]-3,1-Benzoxazin-4-One |