| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SynInnova Laboratories Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (780) 485-2962 | |||
![]() |
sales@syninnova.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | 2-Methyl-5-Hydroxytryptamine |
| Synonyms | Pdsp2_001504; Ncgc00024652-01; Ncgc00024652-03 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.24 |
| CAS Registry Number | 78263-90-8 |
| SMILES | C1=C(O)C=CC2=C1C(=C(C)[NH]2)CCN |
| InChI | 1S/C11H14N2O/c1-7-9(4-5-12)10-6-8(14)2-3-11(10)13-7/h2-3,6,13-14H,4-5,12H2,1H3 |
| InChIKey | WYWNEDARFVJQSG-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.949°C at 760 mmHg (Cal.) |
| Flash point | 208.383°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-Hydroxytryptamine |