|
CAS#: 78273-62-8 Product: 2-(Dichloromethyl)Benzoyl Chloride No suppilers available for the product. |
| Name | 2-(Dichloromethyl)Benzoyl Chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3O |
| Molecular Weight | 223.49 |
| CAS Registry Number | 78273-62-8 |
| EINECS | 278-879-7 |
| SMILES | C1=CC=CC(=C1C(Cl)=O)C(Cl)Cl |
| InChI | 1S/C8H5Cl3O/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7H |
| InChIKey | ZEPFJTAUOKYKKX-UHFFFAOYSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.784°C at 760 mmHg (Cal.) |
| Flash point | 127.369°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dichloromethyl)Benzoyl Chloride |