|
CAS#: 78281-05-7 Product: [(4-Phenylphenyl)-(2,2,2-Trifluoroacetyl)Amino] Acetate No suppilers available for the product. |
| Name | [(4-Phenylphenyl)-(2,2,2-Trifluoroacetyl)Amino] Acetate |
|---|---|
| Synonyms | Acetic Acid [(4-Phenylphenyl)-(2,2,2-Trifluoro-1-Oxoethyl)Amino] Ester; Acetic Acid [(4-Phenylphenyl)-(2,2,2-Trifluoroacetyl)Amino] Ester; [(4-Phenylphenyl)-(2,2,2-Trifluoroethanoyl)Amino] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 |
| CAS Registry Number | 78281-05-7 |
| SMILES | C1=CC(=CC=C1C2=CC=CC=C2)N(C(C(F)(F)F)=O)OC(=O)C |
| InChI | 1S/C16H12F3NO3/c1-11(21)23-20(15(22)16(17,18)19)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | WKUHXEOAHIQDJY-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.384°C at 760 mmHg (Cal.) |
| Flash point | 177.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(4-Phenylphenyl)-(2,2,2-Trifluoroacetyl)Amino] Acetate |