|
CAS#: 78371-89-8 Product: 3-(2-Chlorophenyl)-1-(2-Diethylaminoethyl)-1-Phenylurea Hydrochloride No suppilers available for the product. |
| Name | 3-(2-Chlorophenyl)-1-(2-Diethylaminoethyl)-1-Phenylurea Hydrochloride |
|---|---|
| Synonyms | 3-(2-Chlorophenyl)-1-(2-Diethylaminoethyl)-1-Phenyl-Urea Hydrochloride; 1-(O-Chlorophenyl)-3-(2-(Diethylamino)Ethyl)-3-Phenylurea Hydrochloride; C 5358 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.33 |
| CAS Registry Number | 78371-89-8 |
| SMILES | [H+].C2=C(N(C(=O)NC1=CC=CC=C1Cl)CCN(CC)CC)C=CC=C2.[Cl-] |
| InChI | 1S/C19H24ClN3O.ClH/c1-3-22(4-2)14-15-23(16-10-6-5-7-11-16)19(24)21-18-13-9-8-12-17(18)20;/h5-13H,3-4,14-15H2,1-2H3,(H,21,24);1H |
| InChIKey | GACSAASIYWSDBI-UHFFFAOYSA-N |
| Boiling point | 498.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 255.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chlorophenyl)-1-(2-Diethylaminoethyl)-1-Phenylurea Hydrochloride |