|
CAS#: 78573-70-3 Product: Sodium 2-[5-(4-Chlorophenyl)Pentyl]Oxirane-2-Carboxylate No suppilers available for the product. |
| Name | Sodium 2-[5-(4-Chlorophenyl)Pentyl]Oxirane-2-Carboxylate |
|---|---|
| Synonyms | Sodium 2-[5-(4-Chlorophenyl)Pentyl]-2-Oxiranecarboxylate; 2-(5-(P-Chlorophenyl)Pentyl)Glycidic Acid Sodium Salt; B 807-27 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16ClNaO3 |
| Molecular Weight | 290.72 |
| CAS Registry Number | 78573-70-3 |
| SMILES | C2=C(CCCCCC1(OC1)C([O-])=O)C=CC(=C2)Cl.[Na+] |
| InChI | 1S/C14H17ClO3.Na/c15-12-7-5-11(6-8-12)4-2-1-3-9-14(10-18-14)13(16)17;/h5-8H,1-4,9-10H2,(H,16,17);/q;+1/p-1 |
| InChIKey | VMVZSXFXGNJMPW-UHFFFAOYSA-M |
| Boiling point | 411.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 202.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-[5-(4-Chlorophenyl)Pentyl]Oxirane-2-Carboxylate |