|
CAS#: 78729-88-1 Product: 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Propan-2-Ylphenoxy)Phenyl]Propanoic Acid No suppilers available for the product. |
| Name | 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Propan-2-Ylphenoxy)Phenyl]Propanoic Acid |
|---|---|
| Synonyms | 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Isopropyl-Phenoxy)Phenyl]Propanoic Acid; 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Isopropylphenoxy)Phenyl]Propanoic Acid; 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Isopropyl-Phenoxy)Phenyl]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 |
| CAS Registry Number | 78729-88-1 |
| SMILES | C1=C(CC(C(=O)O)N)C=C(C(=C1CC)OC2=CC=C(C(=C2)C(C)C)O)CC |
| InChI | 1S/C22H29NO4/c1-5-15-9-14(11-19(23)22(25)26)10-16(6-2)21(15)27-17-7-8-20(24)18(12-17)13(3)4/h7-10,12-13,19,24H,5-6,11,23H2,1-4H3,(H,25,26) |
| InChIKey | GKJDPEATLHJZAT-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.15°C at 760 mmHg (Cal.) |
| Flash point | 258.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3-[3,5-Diethyl-4-(4-Hydroxy-3-Propan-2-Ylphenoxy)Phenyl]Propanoic Acid |