|
CAS#: 78987-90-3 Product: Acetic acid 5,6-epoxynorbornan-2-yl ester No suppilers available for the product. |
| Name | Acetic acid 5,6-epoxynorbornan-2-yl ester |
|---|---|
| Synonyms | Acetic Acid, 5,6-Epoxynorbornan-2-Yl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 |
| CAS Registry Number | 78987-90-3 |
| SMILES | CC(OC1C2C3C(C(C1)C2)O3)=O |
| InChI | 1S/C9H12O3/c1-4(10)11-7-3-5-2-6(7)9-8(5)12-9/h5-9H,2-3H2,1H3 |
| InChIKey | MZVAVYNBLGDYCB-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.786°C at 760 mmHg (Cal.) |
| Flash point | 90.137°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acetic acid 5,6-epoxynorbornan-2-yl ester |