|
CAS#: 79380-99-7 Product: N-Acetyl-DL-phenylalanine compd. with tricyclo(3.3.1.1(3,7))decan-1-amine (1:1) No suppilers available for the product. |
| Name | N-Acetyl-DL-phenylalanine compd. with tricyclo(3.3.1.1(3,7))decan-1-amine (1:1) |
|---|---|
| Synonyms | (2S)-2-Acetamido-3-Phenyl-Propanoic Acid; Adamantan-1-Amine; (2S)-2-Acetamido-3-Phenylpropanoic Acid; 1-Adamantanamine; (2S)-2-Acetamido-3-Phenyl-Propionic Acid; 1-Adamantylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 |
| CAS Registry Number | 79380-99-7 |
| SMILES | [C@H](NC(=O)C)(CC1=CC=CC=C1)C(=O)O.NC23CC4CC(C2)CC(C3)C4 |
| InChI | 1S/C11H13NO3.C10H17N/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15);7-9H,1-6,11H2/t10-;/m0./s1 |
| InChIKey | NVJQQPSVBSYLGM-PPHPATTJSA-N |
| Boiling point | 453.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-DL-phenylalanine compd. with tricyclo(3.3.1.1(3,7))decan-1-amine (1:1) |