|
CAS#: 794461-83-9 Product: 5-Methoxy-7-(trifluoromethyl)-1,2,3,4-tetrahydro-2,6-naphthyridine No suppilers available for the product. |
| Name | 5-Methoxy-7-(trifluoromethyl)-1,2,3,4-tetrahydro-2,6-naphthyridine |
|---|---|
| Synonyms | 2,6-Napht |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 |
| CAS Registry Number | 794461-83-9 |
| SMILES | COc1c2c(cc(n1)C(F)(F)F)CNCC2 |
| InChI | 1S/C10H11F3N2O/c1-16-9-7-2-3-14-5-6(7)4-8(15-9)10(11,12)13/h4,14H,2-3,5H2,1H3 |
| InChIKey | JGYNDJDEWPSXGJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.0±40.0°C at 760 mmHg (Cal.) |
| Flash point | 114.1±27.3°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-7-(trifluoromethyl)-1,2,3,4-tetrahydro-2,6-naphthyridine |