|
CAS#: 79746-00-2 Product: Phenyl-(3-Phenyl-1,2,4-Triazol-1-Yl)Methanone No suppilers available for the product. |
| Name | Phenyl-(3-Phenyl-1,2,4-Triazol-1-Yl)Methanone |
|---|---|
| Synonyms | 1-Benzoyl-3-Phenyl-1H-1,2,4-Triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 |
| CAS Registry Number | 79746-00-2 |
| SMILES | C1=NC(=N[N]1C(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C15H11N3O/c19-15(13-9-5-2-6-10-13)18-11-16-14(17-18)12-7-3-1-4-8-12/h1-11H |
| InChIKey | RWZKIUVDWMAQGQ-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.563°C at 760 mmHg (Cal.) |
| Flash point | 226.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl-(3-Phenyl-1,2,4-Triazol-1-Yl)Methanone |