|
CAS#: 79746-01-3 Product: 1-Phenyl-2-(3-Phenyl-1,2,4-Triazol-1-Yl)Ethanone No suppilers available for the product. |
| Name | 1-Phenyl-2-(3-Phenyl-1,2,4-Triazol-1-Yl)Ethanone |
|---|---|
| Synonyms | 1-Phenyl-2-(3-Phenyl-1H-1,2,4-Triazol-1-Yl)Etha* |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 |
| CAS Registry Number | 79746-01-3 |
| SMILES | C3=C(C1=N[N](C=N1)CC(C2=CC=CC=C2)=O)C=CC=C3 |
| InChI | 1S/C16H13N3O/c20-15(13-7-3-1-4-8-13)11-19-12-17-16(18-19)14-9-5-2-6-10-14/h1-10,12H,11H2 |
| InChIKey | GBROBTSBXNXOEJ-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.689°C at 760 mmHg (Cal.) |
| Flash point | 245.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-2-(3-Phenyl-1,2,4-Triazol-1-Yl)Ethanone |