|
CAS#: 79759-87-8 Product: 5-Chloro-1-Methyl-3-Phenylbenzimidazole-2-Thione No suppilers available for the product. |
| Name | 5-Chloro-1-Methyl-3-Phenylbenzimidazole-2-Thione |
|---|---|
| Synonyms | 5-Chloro-1-Methyl-3-Phenyl-Benzimidazole-2-Thione; 5-Chloro-1-Methyl-3-Phenyl-2-Benzimidazolethione; Brn 5554959 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClN2S |
| Molecular Weight | 274.77 |
| CAS Registry Number | 79759-87-8 |
| SMILES | C2=C1N(C(N(C1=CC=C2Cl)C)=S)C3=CC=CC=C3 |
| InChI | 1S/C14H11ClN2S/c1-16-12-8-7-10(15)9-13(12)17(14(16)18)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | FZHOHVPNPYULCT-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.751°C at 760 mmHg (Cal.) |
| Flash point | 202.215°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-1-Methyl-3-Phenylbenzimidazole-2-Thione |