|
CAS#: 79893-63-3 Product: 6-Ethyl-2,10,10-trimethyl-1-oxaspiro[4.5]deca-3,6-diene No suppilers available for the product. |
| Name | 6-Ethyl-2,10,10-trimethyl-1-oxaspiro[4.5]deca-3,6-diene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 |
| CAS Registry Number | 79893-63-3 |
| EINECS | 279-344-0 |
| SMILES | CC1/C=C\C2(O1)C(=C\CCC2(C)C)/CC |
| InChI | 1S/C14H22O/c1-5-12-7-6-9-13(3,4)14(12)10-8-11(2)15-14/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | NHJSLVJXXDHDRV-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.938°C at 760 mmHg (Cal.) |
| Flash point | 115.524°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethyl-2,10,10-trimethyl-1-oxaspiro[4.5]deca-3,6-diene |