|
CAS#: 79928-22-6 Product: 4-[2-(2,6-Dimethyl-Phenyl)-Ethyl]-1H-Imidazole No suppilers available for the product. |
| Name | 4-[2-(2,6-Dimethyl-Phenyl)-Ethyl]-1H-Imidazole |
|---|---|
| Synonyms | 1H-Imidazole, 4-(2-(2,6-Dimethylphenyl)Ethyl)-; 4(5)-2-(2,6-Dimethylphenyl)Ethylimidazole; Mpv 295 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 79928-22-6 |
| SMILES | C1=CC=C(C(=C1C)CCC2=CN=C[NH]2)C |
| InChI | 1S/C13H16N2/c1-10-4-3-5-11(2)13(10)7-6-12-8-14-9-15-12/h3-5,8-9H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | WRAZSLKGTVFTSN-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.958°C at 760 mmHg (Cal.) |
| Flash point | 185.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(2,6-Dimethyl-Phenyl)-Ethyl]-1H-Imidazole |