|
CAS#: 79990-42-4 Product: Moroxybrate No suppilers available for the product. |
| Name | Moroxybrate |
|---|---|
| Synonyms | 2-(4-Chlorophenoxy)-2-Methyl-Propanoic Acid; N-(Diaminomethylene)Morpholine-4-Carboxamidine; 2-(4-Chlorophenoxy)-2-Methylpropanoic Acid; N-(Diaminomethylene)-4-Morpholinecarboxamidine; 2-(4-Chlorophenoxy)-2-Methyl-Propionic Acid; N-(Diaminomethylene)Morpholine-4-Carboxamidine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24ClN5O4 |
| Molecular Weight | 385.85 |
| CAS Registry Number | 79990-42-4 |
| SMILES | C1=C(OC(C)(C)C(O)=O)C=CC(=C1)Cl.C2N(CCOC2)C(N=C(N)N)=N |
| InChI | 1S/C10H11ClO3.C6H13N5O/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8;7-5(8)10-6(9)11-1-3-12-4-2-11/h3-6H,1-2H3,(H,12,13);1-4H2,(H5,7,8,9,10) |
| InChIKey | NEYFONCVOQHZLT-UHFFFAOYSA-N |
| Boiling point | 324.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 149.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Moroxybrate |