|
CAS#: 80030-79-1 Product: 5-Methyl-4-Nitro-N-(Phenylmethyl)-1H-Pyrazole-3-Carboxamide No suppilers available for the product. |
| Name | 5-Methyl-4-Nitro-N-(Phenylmethyl)-1H-Pyrazole-3-Carboxamide |
|---|---|
| Synonyms | N-(Benzyl)-5-Methyl-4-Nitro-1H-Pyrazole-3-Carboxamide; 1H-Pyrazole-3-Carboxamide, 5-Methyl-4-Nitro-N-(Phenylmethyl)-; Brn 4517215 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 |
| CAS Registry Number | 80030-79-1 |
| SMILES | C1=CC=CC=C1CNC(C2=N[NH]C(=C2[N+]([O-])=O)C)=O |
| InChI | 1S/C12H12N4O3/c1-8-11(16(18)19)10(15-14-8)12(17)13-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,13,17)(H,14,15) |
| InChIKey | HPYOXONPVXSOEL-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.039°C at 760 mmHg (Cal.) |
| Flash point | 261.053°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-4-Nitro-N-(Phenylmethyl)-1H-Pyrazole-3-Carboxamide |