|
CAS#: 8003-46-1 Product: Trichlorodinitrobenzene No suppilers available for the product. |
| Name | Trichlorodinitrobenzene |
|---|---|
| Synonyms | 1,3,5-Trichloro-2,4-Dinitro-Benzene; Benzene, 2,4-Dinitro-1,3,5-Trichloro-; Nsc5279 |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl3N2O4 |
| Molecular Weight | 271.44 |
| CAS Registry Number | 8003-46-1 |
| SMILES | C1=C(C(=C(C(=C1Cl)[N+](=O)[O-])Cl)[N+](=O)[O-])Cl |
| InChI | 1S/C6HCl3N2O4/c7-2-1-3(8)6(11(14)15)4(9)5(2)10(12)13/h1H |
| InChIKey | BPMOJGOPWSCNHJ-UHFFFAOYSA-N |
| Density | 1.822g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.806°C at 760 mmHg (Cal.) |
| Flash point | 175.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichlorodinitrobenzene |