|
CAS#: 80037-86-1 Product: 4-[4-(2-Carboxyethyl)-2-methyl-1H-pyrrol-3-yl]-4-oxobutanoic acid No suppilers available for the product. |
| Name | 4-[4-(2-Carboxyethyl)-2-methyl-1H-pyrrol-3-yl]-4-oxobutanoic acid |
|---|---|
| Synonyms | 4-[4-(2-Carboxyethyl)-2-Methyl-1H-Pyrrol-3-Yl]-4-Oxo-Butanoic Acid; 4-[4-(2-Carboxyethyl)-2-Methyl-1H-Pyrrol-3-Yl]-4-Keto-Butyric Acid; 1H-Pyrrole-3-Butanoic Acid, 4-(2-Carboxyethyl)-2-Methyl-Gamma-Oxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 |
| CAS Registry Number | 80037-86-1 |
| SMILES | C1=C(C(=C([NH]1)C)C(CCC(=O)O)=O)CCC(=O)O |
| InChI | 1S/C12H15NO5/c1-7-12(9(14)3-5-11(17)18)8(6-13-7)2-4-10(15)16/h6,13H,2-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NRCLTECUGCYICQ-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.49°C at 760 mmHg (Cal.) |
| Flash point | 286.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[4-(2-Carboxyethyl)-2-methyl-1H-pyrrol-3-yl]-4-oxobutanoic acid |