|
CAS#: 80040-98-8 Product: 2,5,7,8-Tetramethyl-2-(4,8,12-Trimethyltridecyl)-6-Chlorochroman No suppilers available for the product. |
| Name | 2,5,7,8-Tetramethyl-2-(4,8,12-Trimethyltridecyl)-6-Chlorochroman |
|---|---|
| Synonyms | 2,5,7,8-Tetramethyl-2-(4,8,12-Trimethyltridecyl)-6-Chlorochroman; 2H-1-Benzopyran, 6-Chloro-3,4-Dihydro-2,5,7,8-Tetramethyl-2-(4,8,12-Trimethyltridecyl)-, (2R-(2R*(4R*,8R*)))-; Chlorinated Alpha-Tocopherol |
| Molecular Structure | ![]() |
| Molecular Formula | C29H49ClO |
| Molecular Weight | 449.16 |
| CAS Registry Number | 80040-98-8 |
| SMILES | [C@@]2(CCC1=C(C(=C(C(=C1O2)C)C)Cl)C)(CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)C |
| InChI | 1S/C29H49ClO/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
| InChIKey | IEKYONPBVCJRKS-IEOSBIPESA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.819°C at 760 mmHg (Cal.) |
| Flash point | 261.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5,7,8-Tetramethyl-2-(4,8,12-Trimethyltridecyl)-6-Chlorochroman |