Online Database of Chemicals from Around the World
|
CAS#: 80047-67-2 Product: Peroxyhypocrellin No suppilers available for the product. |
| Name | Peroxyhypocrellin |
|---|---|
| Synonyms | Peroxyhypocrellin |
| Molecular Structure |  |
| Molecular Formula | C30H28O12 |
| Molecular Weight | 580.54 |
| CAS Registry Number | 80047-67-2 |
| SMILES | CC1(O)C37OOC1C2=C(OC)C(=O)C(O)C5=C4C2C3=C(C6=C4C(C(=C5)OC)C(=CC6=O)OC)C(=C(OC)C7C(=O)C)O |
| InChI | 1S/C30H28O12/c1-9(31)21-27(40-6)24(34)19-15-11(32)8-13(38-4)16-12(37-3)7-10-14(17(15)16)18-20(26(39-5)25(35)23(10)33)28-29(2,36)30(21,22(18)19)42-41-28/h7-8,16,18,21,23,28,33-34,36H,1-6H3 |
| InChIKey | IJDYTMZCLRHIPL-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 973.275°C at 760 mmHg (Cal.) |
| Flash point | 324.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Peroxyhypocrellin |