|
CAS#: 80156-61-2 Product: N-(Guanin-8-Yl)-1-Naphthylamine No suppilers available for the product. |
| Name | N-(Guanin-8-Yl)-1-Naphthylamine |
|---|---|
| Synonyms | 2-Amino-8-(1-Naphthylamino)-3,7-Dihydropurin-6-One; 6H-Purin-6-One, 2-Amino-1,7-Dihydro-8-(1-Naphthalenylamino)-; G-8-1-Na |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N6O |
| Molecular Weight | 292.30 |
| CAS Registry Number | 80156-61-2 |
| SMILES | C4=C(NC1=NC2=C([NH]1)C(=O)N=C(N2)N)C3=CC=CC=C3C=C4 |
| InChI | 1S/C15H12N6O/c16-14-19-12-11(13(22)21-14)18-15(20-12)17-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H5,16,17,18,19,20,21,22) |
| InChIKey | ZOBGLYSFKBBBCX-UHFFFAOYSA-N |
| Density | 1.645g/cm3 (Cal.) |
|---|---|
| Boiling point | 650.766°C at 760 mmHg (Cal.) |
| Flash point | 347.371°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Guanin-8-Yl)-1-Naphthylamine |