|
CAS#: 80274-92-6 Product: 1,2,4-Tribromo-5-(2,6-Dibromophenyl)Benzene No suppilers available for the product. |
| Name | 1,2,4-Tribromo-5-(2,6-Dibromophenyl)Benzene |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,2',4,5,6'-Pentabromo-; 2,2',4,5,6'-Pentabromo-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Br5 |
| Molecular Weight | 548.69 |
| CAS Registry Number | 80274-92-6 |
| SMILES | C1=C(C(=CC(=C1Br)Br)C2=C(C=CC=C2Br)Br)Br |
| InChI | 1S/C12H5Br5/c13-7-2-1-3-8(14)12(7)6-4-10(16)11(17)5-9(6)15/h1-5H |
| InChIKey | KXIAEPPRBPRPKO-UHFFFAOYSA-N |
| Density | 2.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.841°C at 760 mmHg (Cal.) |
| Flash point | 208.91°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Tribromo-5-(2,6-Dibromophenyl)Benzene |