|
CAS#: 80279-98-7 Product: 3,4-Dihydro-3,4-Dihydroxydibenzo(a,e)Fluoranthene No suppilers available for the product. |
| Name | 3,4-Dihydro-3,4-Dihydroxydibenzo(a,e)Fluoranthene |
|---|---|
| Synonyms | 3,4-Dbfadd; 3,4-Dihydro-3,4-Dihydroxydibenzo(A,E)Fluoranthene; Dibenz(A,E)Aceanthrylene-3,4-Diol, 3,4-Dihydro |
| Molecular Structure | ![]() |
| Molecular Formula | C24H16O2 |
| Molecular Weight | 336.39 |
| CAS Registry Number | 80279-98-7 |
| SMILES | C5=C2C1=CC=CC=C1C3=C2C(=CC4=C3C(C(C=C4)O)O)C6=CC=CC=C56 |
| InChI | 1S/C24H16O2/c25-20-10-9-14-12-18-15-6-2-1-5-13(15)11-19-16-7-3-4-8-17(16)23(22(18)19)21(14)24(20)26/h1-12,20,24-26H |
| InChIKey | GSYBOJMAIWKJDW-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.557°C at 760 mmHg (Cal.) |
| Flash point | 298.992°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-3,4-Dihydroxydibenzo(a,e)Fluoranthene |