|
CAS#: 80299-44-1 Product: 11,13,14,17-Tetrahydrocyclopenta[a]phenanthren-12-one No suppilers available for the product. |
| Name | 11,13,14,17-Tetrahydrocyclopenta[a]phenanthren-12-one |
|---|---|
| Synonyms | Gona-1,3,5,7,9,15-Hexaen-12-One, (13Xi,14Xi)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 |
| CAS Registry Number | 80299-44-1 |
| SMILES | C1=CC=C4C(=C1)C3=C(C2C(CC=C2)C(C3)=O)C=C4 |
| InChI | 1S/C17H14O/c18-17-10-16-12-5-2-1-4-11(12)8-9-14(16)13-6-3-7-15(13)17/h1-6,8-9,13,15H,7,10H2 |
| InChIKey | AFXYVYPXVYFOKL-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.968°C at 760 mmHg (Cal.) |
| Flash point | 190.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,13,14,17-Tetrahydrocyclopenta[a]phenanthren-12-one |