|
CAS#: 80333-65-9 Product: 3,3',4,4'-Tetrachloro-1,1'-biphenyl No suppilers available for the product. |
| Name | 3,3',4,4'-Tetrachloro-1,1'-biphenyl |
|---|---|
| Synonyms | Biphenyl, 3,3',4,4'-Tetrachloro-; Hsdb 3949; Pcb 77 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.99 |
| CAS Registry Number | 80333-65-9 |
| SMILES | C1=C(C=CC(=C1Cl)Cl)C2=CC=C(C(=C2)Cl)Cl |
| InChI | 1S/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
| InChIKey | UQMGJOKDKOLIDP-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.713°C at 760 mmHg (Cal.) |
| Flash point | 188.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3',4,4'-Tetrachloro-1,1'-biphenyl |