|
CAS#: 80449-58-7 Product: Acetyl Cedrene No suppilers available for the product. |
| Name | Acetyl Cedrene |
|---|---|
| Synonyms | Acetyl Cedrene |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 |
| CAS Registry Number | 80449-58-7 |
| SMILES | [C@@H]13[C@]2(C[C@@H](C1(C)C)[C@@H](CC2)C)\C(CC3)=C/C(=O)C |
| InChI | 1S/C17H26O/c1-11-7-8-17-10-14(11)16(3,4)15(17)6-5-13(17)9-12(2)18/h9,11,14-15H,5-8,10H2,1-4H3/b13-9-/t11-,14-,15+,17-/m1/s1 |
| InChIKey | WXETUDXXEZHSCS-MAVITOTKSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.428°C at 760 mmHg (Cal.) |
| Flash point | 156.338°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetyl Cedrene |