|
CAS#: 80453-42-5 Product: 6,8-Dimethoxy-3-(1-Methylethylidene)-1,4-Benzodioxin-2(3H)-One No suppilers available for the product. |
| Name | 6,8-Dimethoxy-3-(1-Methylethylidene)-1,4-Benzodioxin-2(3H)-One |
|---|---|
| Synonyms | 2-Isopropylidene-5,7-Dimethoxy-1,4-Benzodioxin-3-One; 1,4-Benzodioxin-2(3H)-One, 6,8-Dimethoxy-3-(1-Methylethylidene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 80453-42-5 |
| SMILES | C1=C(OC)C=C(C2=C1OC(C(O2)=O)=C(C)C)OC |
| InChI | 1S/C13H14O5/c1-7(2)11-13(14)18-12-9(16-4)5-8(15-3)6-10(12)17-11/h5-6H,1-4H3 |
| InChIKey | RUSOQDVMBDLJIA-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.355°C at 760 mmHg (Cal.) |
| Flash point | 182.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dimethoxy-3-(1-Methylethylidene)-1,4-Benzodioxin-2(3H)-One |