|
CAS#: 80462-91-5 Product: 2-Cyclobutylamino-5,6-Dihydroxy-1,2,3,4-Tetrahydro-1-Naphthalenol No suppilers available for the product. |
| Name | 2-Cyclobutylamino-5,6-Dihydroxy-1,2,3,4-Tetrahydro-1-Naphthalenol |
|---|---|
| Synonyms | 2-(Cyclobutylamino)Tetralin-1,5,6-Triol; 2-Cba-Dh-To; 2-Cyclobutylamino-5,6-Dihydroxy-1,2,3,4-Tetrahydro-1-Naphthalenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 |
| CAS Registry Number | 80462-91-5 |
| SMILES | C1=C3C(=C(O)C(=C1)O)CCC(NC2CCC2)C3O |
| InChI | 1S/C14H19NO3/c16-12-7-5-9-10(14(12)18)4-6-11(13(9)17)15-8-2-1-3-8/h5,7-8,11,13,15-18H,1-4,6H2 |
| InChIKey | OEOKMDWQGVGKEL-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.029°C at 760 mmHg (Cal.) |
| Flash point | 193.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyclobutylamino-5,6-Dihydroxy-1,2,3,4-Tetrahydro-1-Naphthalenol |