|
CAS#: 80558-61-8 Product: 11-Deoxy-16-Phenoxy-17,18,19,20-Tetranorprostaglandin E1 No suppilers available for the product. |
| Name | 11-Deoxy-16-Phenoxy-17,18,19,20-Tetranorprostaglandin E1 |
|---|---|
| Synonyms | 7-[(1R,2R)-2-[(E,3R)-3-Hydroxy-4-(Phenoxy)But-1-Enyl]-5-Oxo-Cyclopentyl]Heptanoic Acid; 7-[(1R,2R)-2-[(E,3R)-3-Hydroxy-4-(Phenoxy)But-1-Enyl]-5-Keto-Cyclopentyl]Enanthic Acid; Mb 28767 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| CAS Registry Number | 80558-61-8 |
| SMILES | [C@@H]1(CCC([C@@H]1CCCCCCC(O)=O)=O)\C=C\[C@H](COC2=CC=CC=C2)O |
| InChI | 1S/C22H30O5/c23-18(16-27-19-8-4-3-5-9-19)14-12-17-13-15-21(24)20(17)10-6-1-2-7-11-22(25)26/h3-5,8-9,12,14,17-18,20,23H,1-2,6-7,10-11,13,15-16H2,(H,25,26)/b14-12+/t17-,18+,20+/m0/s1 |
| InChIKey | NZGFSDWJUZOAAX-KAVAACISSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.655°C at 760 mmHg (Cal.) |
| Flash point | 200.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Deoxy-16-Phenoxy-17,18,19,20-Tetranorprostaglandin E1 |