Online Database of Chemicals from Around the World
|
CAS#: 80568-60-1 Product: 1-(3-Dimethylaminopropylamino)-2-Hydroxy-4-Methyl-Thioxanthen-9-One No suppilers available for the product. |
| Name | 1-(3-Dimethylaminopropylamino)-2-Hydroxy-4-Methyl-Thioxanthen-9-One |
|---|---|
| Synonyms | 1-(3-Dimethylaminopropylamino)-2-Hydroxy-4-Methyl-Thioxanthen-9-One; 1-(3-Dimethylaminopropylamino)-2-Hydroxy-4-Methyl-9-Thioxanthenone; Nsc306667 |
| Molecular Structure |  |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 |
| CAS Registry Number | 80568-60-1 |
| SMILES | C1=C(O)C(=C2C(=C1C)SC3=C(C2=O)C=CC=C3)NCCCN(C)C |
| InChI | 1S/C19H22N2O2S/c1-12-11-14(22)17(20-9-6-10-21(2)3)16-18(23)13-7-4-5-8-15(13)24-19(12)16/h4-5,7-8,11,20,22H,6,9-10H2,1-3H3 |
| InChIKey | NAKHPTXIXJMMRR-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.388°C at 760 mmHg (Cal.) |
| Flash point | 273.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Dimethylaminopropylamino)-2-Hydroxy-4-Methyl-Thioxanthen-9-One |