|
CAS#: 80589-24-8 Product: 2-(1'-Propenyl)-4-Ethoxymethylene-5-Oxazolone No suppilers available for the product. |
| Name | 2-(1'-Propenyl)-4-Ethoxymethylene-5-Oxazolone |
|---|---|
| Synonyms | (4E)-4-(Ethoxymethylene)-2-[(E)-Prop-1-Enyl]Oxazol-5-One; (4E)-4-(Ethoxymethylene)-2-[(E)-Prop-1-Enyl]-5-Oxazolone; 2-(1'-Propenyl)-4-Ethoxymethylene-5-Oxazolone |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 80589-24-8 |
| SMILES | C(O\C=C/1N=C(OC1=O)\C=C\C)C |
| InChI | 1S/C9H11NO3/c1-3-5-8-10-7(6-12-4-2)9(11)13-8/h3,5-6H,4H2,1-2H3/b5-3+,7-6+ |
| InChIKey | WUTPTMHTKZTTIE-TWTPFVCWSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.453°C at 760 mmHg (Cal.) |
| Flash point | 96.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1'-Propenyl)-4-Ethoxymethylene-5-Oxazolone |