|
CAS#: 806-71-3 Product: 1,2,3,4-Tetraphenyl-1,3-Butadiene No suppilers available for the product. |
| Name | 1,2,3,4-Tetraphenyl-1,3-Butadiene |
|---|---|
| Synonyms | [(3E)-1,3,4-Tri(Phenyl)Buta-1,3-Dien-2-Yl]Benzene; [(1E,3E)-1,3,4-Tri(Phenyl)Buta-1,3-Dien-2-Yl]Benzene; [(E,1E)-2,3-Di(Phenyl)-1-(Phenylmethylene)Prop-2-Enyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C28H22 |
| Molecular Weight | 358.48 |
| CAS Registry Number | 806-71-3 (1608-11-3) |
| SMILES | C4=C(C(/C(C1=CC=CC=C1)=C/C2=CC=CC=C2)=C\C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C28H22/c1-5-13-23(14-6-1)21-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)22-24-15-7-2-8-16-24/h1-22H/b27-21+,28-22+ |
| InChIKey | DAABVBOFAIYKNX-GPAWKIAZSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.112°C at 760 mmHg (Cal.) |
| Flash point | 252.533°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Joaquín López-Serrano, Simon B. Duckett, John P. Dunne, Cyril Godard and Adrian C. Whitwood. Palladium catalysed alkyne hydrogenation and oligomerisation: a parahydrogen based NMR investigation, Dalton Trans., 2008, 4270. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetraphenyl-1,3-Butadiene |