|
CAS#: 80615-54-9 Product: Methyl 3-acetamido-5-nitro-2-thiophenecarboxylate No suppilers available for the product. |
| Name | Methyl 3-acetamido-5-nitro-2-thiophenecarboxylate |
|---|---|
| Synonyms | 3-acetyla |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O5S |
| Molecular Weight | 244.22 |
| CAS Registry Number | 80615-54-9 |
| SMILES | O=[N+]([O-])c1cc(NC(C)=O)c(s1)C(=O)OC |
| InChI | 1S/C8H8N2O5S/c1-4(11)9-5-3-6(10(13)14)16-7(5)8(12)15-2/h3H,1-2H3,(H,9,11) |
| InChIKey | DJPJTIGJPWASOS-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.893°C at 760 mmHg (Cal.) |
| Flash point | 237.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-acetamido-5-nitro-2-thiophenecarboxylate |