|
CAS#: 80789-78-2 Product: Naphthalene-2,3-Diamine Hydrochloride No suppilers available for the product. |
| Name | Naphthalene-2,3-Diamine Hydrochloride |
|---|---|
| Synonyms | (3-Amino-2-Naphthyl)Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 |
| CAS Registry Number | 80789-78-2 |
| EINECS | 279-558-4 |
| SMILES | [H+].C1=C(N)C(=CC2=CC=CC=C12)N.[Cl-] |
| InChI | 1S/C10H10N2.ClH/c11-9-5-7-3-1-2-4-8(7)6-10(9)12;/h1-6H,11-12H2;1H |
| InChIKey | NFDJXVMIVTUFCG-UHFFFAOYSA-N |
| Boiling point | 370.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthalene-2,3-Diamine Hydrochloride |