|
CAS#: 80-81-9 Product: 6-Ethyl-1,2,3,4-Tetrahydro-1,1,4,4-Tetramethylnaphthalene No suppilers available for the product. |
| Name | 6-Ethyl-1,2,3,4-Tetrahydro-1,1,4,4-Tetramethylnaphthalene |
|---|---|
| Synonyms | 6-Ethyl-1,1,4,4-Tetramethyl-Tetralin; 6-Ethyl-1,1,4,4-Tetramethyltetralin; 1,1,4,4-Tetramethyl-1,2,3,4-Tetrahydro-6-Ethylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 |
| CAS Registry Number | 80-81-9 |
| EINECS | 201-310-0 |
| SMILES | C1=C(C=C2C(=C1)C(CCC2(C)C)(C)C)CC |
| InChI | 1S/C16H24/c1-6-12-7-8-13-14(11-12)16(4,5)10-9-15(13,2)3/h7-8,11H,6,9-10H2,1-5H3 |
| InChIKey | SLIOAQVQWDNBNB-UHFFFAOYSA-N |
| Density | 0.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.032°C at 760 mmHg (Cal.) |
| Flash point | 118.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethyl-1,2,3,4-Tetrahydro-1,1,4,4-Tetramethylnaphthalene |