|
CAS#: 80830-37-1 Product: 2,5-Dimethoxy-4-Nitroazobenzene No suppilers available for the product. |
| Name | 2,5-Dimethoxy-4-Nitroazobenzene |
|---|---|
| Synonyms | (2,5-Dimethoxy-4-Nitro-Phenyl)-Phenyl-Diazene; 2,5-Dimethoxy-4-Nitroazobenzene; Azobenzene, 2,5-Dimethoxy-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 |
| CAS Registry Number | 80830-37-1 |
| SMILES | C1=C([N+]([O-])=O)C(=CC(=C1OC)N=NC2=CC=CC=C2)OC |
| InChI | 1S/C14H13N3O4/c1-20-13-9-12(17(18)19)14(21-2)8-11(13)16-15-10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | OUTAMTFNSWLMSN-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.497°C at 760 mmHg (Cal.) |
| Flash point | 237.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethoxy-4-Nitroazobenzene |