| BIOLOG Life Science Institute | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (421) 591-355 | |||
![]() |
service@biolog.de | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (S)-2'-Deoxyadenosine 5'-P''-ester with thiotriphosphoric acid |
|---|---|
| Synonyms | [[(2R,3S)-5-(6-Aminopurin-9-Yl)-3-Hydroxy-Tetrahydrofuran-2-Yl]Methoxy-Hydroxy-Phosphinothioyl] Phosphono Hydrogen Phosphate; [[(2R,3S)-5-(6-Amino-9-Purinyl)-3-Hydroxy-2-Tetrahydrofuranyl]Methoxy-Hydroxyphosphinothioyl] Phosphono Hydrogen Phosphate; [[(2R,3S)-5-(6-Aminopurin-9-Yl)-3-Hydroxy-Tetrahydrofuran-2-Yl]Methoxy-Hydroxy-Thiophosphoryl] Phosphono Hydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N5O11P3S |
| Molecular Weight | 507.24 |
| CAS Registry Number | 80875-87-2 |
| SMILES | [C@@H]3(O)[C@H](OC([N]2C1=NC=NC(=C1N=C2)N)C3)CO[P](=S)(O[P](O[P](O)(O)=O)(O)=O)O |
| InChI | 1S/C10H16N5O11P3S/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(24-7)2-23-29(22,30)26-28(20,21)25-27(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H,22,30)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7?,29?/m0/s1 |
| InChIKey | CCPIKNHZOWQALM-SQJSSBPESA-N |
| Density | 2.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 903.549°C at 760 mmHg (Cal.) |
| Flash point | 500.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-2'-Deoxyadenosine 5'-P''-ester with thiotriphosphoric acid |