Online Database of Chemicals from Around the World
|
CAS#: 80887-78-1 Product: Dimethyl (4-Hydroxyphenyl)Malonate No suppilers available for the product. |
| Name | Dimethyl (4-Hydroxyphenyl)Malonate |
|---|---|
| Synonyms | 2-(4-Hydroxyphenyl)Propanedioic Acid Dimethyl Ester; 2-(4-Hydroxyphenyl)Malonic Acid Dimethyl Ester; Dimethyl (4-Hydroxyphenyl)Malonate |
| Molecular Structure |  |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 80887-78-1 |
| EINECS | 279-615-3 |
| SMILES | C1=C(O)C=CC(=C1)C(C(OC)=O)C(OC)=O |
| InChI | 1S/C11H12O5/c1-15-10(13)9(11(14)16-2)7-3-5-8(12)6-4-7/h3-6,9,12H,1-2H3 |
| InChIKey | LWIPABRAHRZWNP-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.112°C at 760 mmHg (Cal.) |
| Flash point | 121.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4-Hydroxyphenyl)Malonate |