|
CAS#: 80981-48-2 Product: Octamethylene Bis(Methanethiosulfonate) No suppilers available for the product. |
| Name | Octamethylene Bis(Methanethiosulfonate) |
|---|---|
| Synonyms | 8-Methylsulfonothioyloxyoctoxysulfonothioylmethane; Methanesulfonothioic-35S Acid, 35S,35S'-1,8-Octanediyl Ester; Ombts |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22O4S4 |
| Molecular Weight | 334.52 |
| CAS Registry Number | 80981-48-2 |
| SMILES | C(CCCCCCCO[S](C)(=O)=S)O[S](C)(=O)=S |
| InChI | 1S/C10H22O4S4/c1-17(11,15)13-9-7-5-3-4-6-8-10-14-18(2,12)16/h3-10H2,1-2H3 |
| InChIKey | VVWVLNYCUFMGIO-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.788°C at 760 mmHg (Cal.) |
| Flash point | 216.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octamethylene Bis(Methanethiosulfonate) |