|
CAS#: 80994-60-1 Product: 2-Methylthio-N-Isopropylacetanilide No suppilers available for the product. |
| Name | 2-Methylthio-N-Isopropylacetanilide |
|---|---|
| Synonyms | N-Isopropyl-2-Methylsulfanyl-N-Phenyl-Acetamide; N-Isopropyl-2-(Methylthio)-N-Phenylacetamide; N-Isopropyl-2-(Methylthio)-N-Phenyl-Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.33 |
| CAS Registry Number | 80994-60-1 |
| SMILES | C1=C(N(C(CSC)=O)C(C)C)C=CC=C1 |
| InChI | 1S/C12H17NOS/c1-10(2)13(12(14)9-15-3)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | VOMLLTOADFQSBS-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.277°C at 760 mmHg (Cal.) |
| Flash point | 145.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylthio-N-Isopropylacetanilide |