|
CAS#: 80998-48-7 Product: Methyl 4-methyl-4-nitroso-2-[(trimethylsilyl)oxy]pentanoate No suppilers available for the product. |
| Name | Methyl 4-methyl-4-nitroso-2-[(trimethylsilyl)oxy]pentanoate |
|---|---|
| Synonyms | Methyl 4- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.36 |
| CAS Registry Number | 80998-48-7 |
| SMILES | O=NC(CC(O[Si](C)(C)C)C(=O)OC)(C)C |
| InChI | 1S/C10H21NO4Si/c1-10(2,11-13)7-8(9(12)14-3)15-16(4,5)6/h8H,7H2,1-6H3 |
| InChIKey | BSZOQCQSNLQJBV-UHFFFAOYSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.896°C at 760 mmHg (Cal.) |
| Flash point | 116.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-methyl-4-nitroso-2-[(trimethylsilyl)oxy]pentanoate |